C24H19F2NO3 — CID 140712243
benzyl 4-carbamoyl-3-[(1R)-4,6-difluoro-2,3-dihydro-1H-inden-1-yl]benzoate (PubChem CID 140712243) has the molecular formula C24H19F2NO3 and a molecular weight of 407.42 g/mol. Its IUPAC name is benzyl 4-carbamoyl-3-[(1R)-4,6-difluoro-2,3-dihydro-1H-inden-1-yl]benzoate.
| Compound Name | benzyl 4-carbamoyl-3-[(1R)-4,6-difluoro-2,3-dihydro-1H-inden-1-yl]benzoate |
|---|---|
| PubChem CID | 140712243 |
| Molecular Formula | C24H19F2NO3 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | benzyl 4-carbamoyl-3-[(1R)-4,6-difluoro-2,3-dihydro-1H-inden-1-yl]benzoate |
| SMILES | NC(=O)c1ccc(C(=O)OCc2ccccc2)cc1[C@H]1CCc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C24H19F2NO3/c25-16-11-21-17(8-9-18(21)22(26)12-16)20-10-15(6-7-19(20)23(27)28)24(29)30-13-14-4-2-1-3-5-14/h1-7,10-12,17H,8-9,13H2,(H2,27,28)/t17-/m1/s1 |
| InChIKey | LCZBKJFPZJJEOU-QGZVFWFLSA-N |
| XLogP | 4.50 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |