About disodium;dihydrogen phosphate;benzoate
disodium;dihydrogen phosphate;benzoate (PubChem CID 140714238) has the molecular formula C7H7Na2O6P
and a molecular weight of 264.08 g/mol. Its IUPAC name is disodium;dihydrogen phosphate;benzoate.
Molecular Properties
| Compound Name | disodium;dihydrogen phosphate;benzoate |
| PubChem CID | 140714238 |
| Molecular Formula | C7H7Na2O6P |
| Molecular Weight | 264.08 g/mol |
| Exact Mass | 263.98 |
| IUPAC Name | disodium;dihydrogen phosphate;benzoate |
| SMILES | O=C([O-])c1ccccc1.O=P([O-])(O)O.[Na+].[Na+] |
| InChI | InChI=1S/C7H6O2.2Na.H3O4P/c8-7(9)6-4-2-1-3-5-6;;;1-5(2,3)4/h1-5H,(H,8,9);;;(H3,1,2,3,4)/q;2*+1;/p-2 |
| InChIKey | HDNRWEYMGPDKFT-UHFFFAOYSA-L |
| XLogP | -7.50 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.08 |
| LogP ≤ 5 | -7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;dihydrogen phosphate;benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;dihydrogen phosphate;benzoate?
The IUPAC name of disodium;dihydrogen phosphate;benzoate (CID 140714238) is disodium;dihydrogen phosphate;benzoate.
What is the SMILES notation for disodium;dihydrogen phosphate;benzoate?
The canonical SMILES for disodium;dihydrogen phosphate;benzoate is O=C([O-])c1ccccc1.O=P([O-])(O)O.[Na+].[Na+].
What is the InChIKey of disodium;dihydrogen phosphate;benzoate?
The InChIKey is HDNRWEYMGPDKFT-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H6O2.2Na.H3O4P/c8-7(9)6-4-2-1-3-5-6;;;1-5(2,3)4/h1-5H,(H,8,9);;;(H3,1,2,3,4)/q;2*+1;/p-2.
What are the key properties of disodium;dihydrogen phosphate;benzoate?
disodium;dihydrogen phosphate;benzoate has a molecular weight of 264.08 g/mol, XLogP of -7.50, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;dihydrogen phosphate;benzoate is sourced from PubChem (CID 140714238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).