C20H33O6S+ — CID 140722673
4-[4-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-1,4-oxathian-4-ium (PubChem CID 140722673) has the molecular formula C20H33O6S+ and a molecular weight of 401.55 g/mol. Its IUPAC name is 4-[4-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-1,4-oxathian-4-ium.
| Compound Name | 4-[4-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-1,4-oxathian-4-ium |
|---|---|
| PubChem CID | 140722673 |
| Molecular Formula | C20H33O6S+ |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 4-[4-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-1,4-oxathian-4-ium |
| SMILES | CCOCCOCCOCCOCCOc1ccc([S+]2CCOCC2)cc1 |
| InChI | InChI=1S/C20H33O6S/c1-2-21-7-8-22-9-10-23-11-12-24-13-14-26-19-3-5-20(6-4-19)27-17-15-25-16-18-27/h3-6H,2,7-18H2,1H3/q+1 |
| InChIKey | GFVCVQYBKNGHGW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|