C15H23O3S+ — CID 160927234
4-[4-(2-propan-2-yloxyethoxy)phenyl]-1,4-oxathian-4-ium (PubChem CID 160927234) has the molecular formula C15H23O3S+ and a molecular weight of 283.41 g/mol. Its IUPAC name is 4-[4-(2-propan-2-yloxyethoxy)phenyl]-1,4-oxathian-4-ium.
| Compound Name | 4-[4-(2-propan-2-yloxyethoxy)phenyl]-1,4-oxathian-4-ium |
|---|---|
| PubChem CID | 160927234 |
| Molecular Formula | C15H23O3S+ |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 4-[4-(2-propan-2-yloxyethoxy)phenyl]-1,4-oxathian-4-ium |
| SMILES | CC(C)OCCOc1ccc([S+]2CCOCC2)cc1 |
| InChI | InChI=1S/C15H23O3S/c1-13(2)17-7-8-18-14-3-5-15(6-4-14)19-11-9-16-10-12-19/h3-6,13H,7-12H2,1-2H3/q+1 |
| InChIKey | NPPJJYJMRPDXBT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|