C22H34F3N5O4S — CID 140731599
ethyl N-[2-[[3-[4-(trifluoromethyl)cyclohexyl]-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyrazine-6-carbonyl]amino]thiolane-3-carbonyl]carbamate (PubChem CID 140731599) has the molecular formula C22H34F3N5O4S and a molecular weight of 521.61 g/mol. Its IUPAC name is ethyl N-[2-[[3-[4-(trifluoromethyl)cyclohexyl]-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyrazine-6-carbonyl]amino]thiolane-3-carbonyl]carbamate.
| Compound Name | ethyl N-[2-[[3-[4-(trifluoromethyl)cyclohexyl]-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyrazine-6-carbonyl]amino]thiolane-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 140731599 |
| Molecular Formula | C22H34F3N5O4S |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | ethyl N-[2-[[3-[4-(trifluoromethyl)cyclohexyl]-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyrazine-6-carbonyl]amino]thiolane-3-carbonyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C1CCSC1NC(=O)C1CN2C(CN1)NCC2C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H34F3N5O4S/c1-2-34-21(33)29-18(31)14-7-8-35-20(14)28-19(32)15-11-30-16(9-27-17(30)10-26-15)12-3-5-13(6-4-12)22(23,24)25/h12-17,20,26-27H,2-11H2,1H3,(H,28,32)(H,29,31,33) |
| InChIKey | LHOLEHQJRJIXTL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |