C16H26N4O4S — CID 123917363
ethyl N-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,2-b]pyridine-6-carbonylamino)thiolane-3-carbonyl]carbamate (PubChem CID 123917363) has the molecular formula C16H26N4O4S and a molecular weight of 370.48 g/mol. Its IUPAC name is ethyl N-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,2-b]pyridine-6-carbonylamino)thiolane-3-carbonyl]carbamate.
| Compound Name | ethyl N-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,2-b]pyridine-6-carbonylamino)thiolane-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 123917363 |
| Molecular Formula | C16H26N4O4S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | ethyl N-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,2-b]pyridine-6-carbonylamino)thiolane-3-carbonyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C1CCSC1NC(=O)C1CNC2CCNC2C1 |
| InChI | InChI=1S/C16H26N4O4S/c1-2-24-16(23)20-14(22)10-4-6-25-15(10)19-13(21)9-7-12-11(18-8-9)3-5-17-12/h9-12,15,17-18H,2-8H2,1H3,(H,19,21)(H,20,22,23) |
| InChIKey | OYFZAYZTAUZUGC-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |