C21H21FN2O5S — CID 123948335
ethyl N-[2-[[4-(4-fluorophenoxy)benzoyl]amino]thiolane-3-carbonyl]carbamate (PubChem CID 123948335) has the molecular formula C21H21FN2O5S and a molecular weight of 432.47 g/mol. Its IUPAC name is ethyl N-[2-[[4-(4-fluorophenoxy)benzoyl]amino]thiolane-3-carbonyl]carbamate.
| Compound Name | ethyl N-[2-[[4-(4-fluorophenoxy)benzoyl]amino]thiolane-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 123948335 |
| Molecular Formula | C21H21FN2O5S |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | ethyl N-[2-[[4-(4-fluorophenoxy)benzoyl]amino]thiolane-3-carbonyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C1CCSC1NC(=O)c1ccc(Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H21FN2O5S/c1-2-28-21(27)24-19(26)17-11-12-30-20(17)23-18(25)13-3-7-15(8-4-13)29-16-9-5-14(22)6-10-16/h3-10,17,20H,2,11-12H2,1H3,(H,23,25)(H,24,26,27) |
| InChIKey | XQOAYGUMACTGHS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |