C20H27N3O6S2 — CID 123249845
2-(2-ethoxyethoxy)ethyl N-[2-(2,3-dihydro-1,3-benzothiazole-2-carbonylamino)thiolane-3-carbonyl]carbamate (PubChem CID 123249845) has the molecular formula C20H27N3O6S2 and a molecular weight of 469.59 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)ethyl N-[2-(2,3-dihydro-1,3-benzothiazole-2-carbonylamino)thiolane-3-carbonyl]carbamate.
| Compound Name | 2-(2-ethoxyethoxy)ethyl N-[2-(2,3-dihydro-1,3-benzothiazole-2-carbonylamino)thiolane-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 123249845 |
| Molecular Formula | C20H27N3O6S2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 2-(2-ethoxyethoxy)ethyl N-[2-(2,3-dihydro-1,3-benzothiazole-2-carbonylamino)thiolane-3-carbonyl]carbamate |
| SMILES | CCOCCOCCOC(=O)NC(=O)C1CCSC1NC(=O)C1Nc2ccccc2S1 |
| InChI | InChI=1S/C20H27N3O6S2/c1-2-27-8-9-28-10-11-29-20(26)23-16(24)13-7-12-30-18(13)22-17(25)19-21-14-5-3-4-6-15(14)31-19/h3-6,13,18-19,21H,2,7-12H2,1H3,(H,22,25)(H,23,24,26) |
| InChIKey | QKRRPMTWZBZHFW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|