C20H25N3O4S2 — CID 123736807
ethyl N-[2-(2,3-dihydro-1,3-benzothiazole-2-carbonylamino)-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene-3-carbonyl]carbamate (PubChem CID 123736807) has the molecular formula C20H25N3O4S2 and a molecular weight of 435.57 g/mol. Its IUPAC name is ethyl N-[2-(2,3-dihydro-1,3-benzothiazole-2-carbonylamino)-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene-3-carbonyl]carbamate.
| Compound Name | ethyl N-[2-(2,3-dihydro-1,3-benzothiazole-2-carbonylamino)-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 123736807 |
| Molecular Formula | C20H25N3O4S2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | ethyl N-[2-(2,3-dihydro-1,3-benzothiazole-2-carbonylamino)-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene-3-carbonyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C1C(NC(=O)C2Nc3ccccc3S2)SC2CCCCC21 |
| InChI | InChI=1S/C20H25N3O4S2/c1-2-27-20(26)23-16(24)15-11-7-3-5-9-13(11)28-18(15)22-17(25)19-21-12-8-4-6-10-14(12)29-19/h4,6,8,10-11,13,15,18-19,21H,2-3,5,7,9H2,1H3,(H,22,25)(H,23,24,26) |
| InChIKey | UJCAETNELIOWFO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |