C18H21N3O4S2 — CID 123986344
ethyl N-[2-[3-(2,3-dihydro-1,3-benzothiazol-2-yl)prop-2-enoylamino]thiolane-3-carbonyl]carbamate (PubChem CID 123986344) has the molecular formula C18H21N3O4S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is ethyl N-[2-[3-(2,3-dihydro-1,3-benzothiazol-2-yl)prop-2-enoylamino]thiolane-3-carbonyl]carbamate.
| Compound Name | ethyl N-[2-[3-(2,3-dihydro-1,3-benzothiazol-2-yl)prop-2-enoylamino]thiolane-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 123986344 |
| Molecular Formula | C18H21N3O4S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | ethyl N-[2-[3-(2,3-dihydro-1,3-benzothiazol-2-yl)prop-2-enoylamino]thiolane-3-carbonyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C1CCSC1NC(=O)C=CC1Nc2ccccc2S1 |
| InChI | InChI=1S/C18H21N3O4S2/c1-2-25-18(24)21-16(23)11-9-10-26-17(11)20-14(22)7-8-15-19-12-5-3-4-6-13(12)27-15/h3-8,11,15,17,19H,2,9-10H2,1H3,(H,20,22)(H,21,23,24) |
| InChIKey | KDPOOTGESFBTEO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|