C23H36N2O4S2 — CID 123408809
ethyl N-[2-(2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene-3-carbonylamino)-5-cyclohexylthiolane-3-carbonyl]carbamate (PubChem CID 123408809) has the molecular formula C23H36N2O4S2 and a molecular weight of 468.69 g/mol. Its IUPAC name is ethyl N-[2-(2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene-3-carbonylamino)-5-cyclohexylthiolane-3-carbonyl]carbamate.
| Compound Name | ethyl N-[2-(2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene-3-carbonylamino)-5-cyclohexylthiolane-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 123408809 |
| Molecular Formula | C23H36N2O4S2 |
| Molecular Weight | 468.69 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | ethyl N-[2-(2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene-3-carbonylamino)-5-cyclohexylthiolane-3-carbonyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C1CC(C2CCCCC2)SC1NC(=O)C1CSC2CCCCC21 |
| InChI | InChI=1S/C23H36N2O4S2/c1-2-29-23(28)25-20(26)16-12-19(14-8-4-3-5-9-14)31-22(16)24-21(27)17-13-30-18-11-7-6-10-15(17)18/h14-19,22H,2-13H2,1H3,(H,24,27)(H,25,26,28) |
| InChIKey | VTPKFMCPOGNOCG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.69 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |