C19H21N6O2S+ — CID 140733035
cis-(1S,3R)-3-[5-(4-methylphenyl)sulfonyl-1,7,10,11-tetraza-5-azoniatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-12-yl]cyclopentan-1-amine (PubChem CID 140733035) has the molecular formula C19H21N6O2S+ and a molecular weight of 397.48 g/mol. Its IUPAC name is cis-(1S,3R)-3-[5-(4-methylphenyl)sulfonyl-1,7,10,11-tetraza-5-azoniatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-12-yl]cyclopentan-1-amine.
| Compound Name | cis-(1S,3R)-3-[5-(4-methylphenyl)sulfonyl-1,7,10,11-tetraza-5-azoniatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-12-yl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 140733035 |
| Molecular Formula | C19H21N6O2S+ |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | cis-(1S,3R)-3-[5-(4-methylphenyl)sulfonyl-1,7,10,11-tetraza-5-azoniatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-12-yl]cyclopentan-1-amine |
| SMILES | Cc1ccc(S(=O)(=O)[N+]2=CCc3c2ncc2nnc([C@@H]4CC[C@H](N)C4)n32)cc1 |
| InChI | InChI=1S/C19H21N6O2S/c1-12-2-6-15(7-3-12)28(26,27)24-9-8-16-19(24)21-11-17-22-23-18(25(16)17)13-4-5-14(20)10-13/h2-3,6-7,9,11,13-14H,4-5,8,10,20H2,1H3/q+1/t13-,14+/m1/s1 |
| InChIKey | HKIMMKAENKFIAY-KGLIPLIRSA-N |
| XLogP | 1.69 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|