C12H17N3 — CID 140735408
7-tert-butyl-2,4-dimethylpyrrolo[2,3-d]pyrimidine (PubChem CID 140735408) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 7-tert-butyl-2,4-dimethylpyrrolo[2,3-d]pyrimidine.
| Compound Name | 7-tert-butyl-2,4-dimethylpyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 140735408 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 7-tert-butyl-2,4-dimethylpyrrolo[2,3-d]pyrimidine |
| SMILES | Cc1nc(C)c2ccn(C(C)(C)C)c2n1 |
| InChI | InChI=1S/C12H17N3/c1-8-10-6-7-15(12(3,4)5)11(10)14-9(2)13-8/h6-7H,1-5H3 |
| InChIKey | ABGNWBHISFTCKN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |