C15H21N3O — CID 157442770
7-(3,3-dimethylbut-1-en-2-yloxymethyl)-2,4-dimethylpyrrolo[2,3-d]pyrimidine (PubChem CID 157442770) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 7-(3,3-dimethylbut-1-en-2-yloxymethyl)-2,4-dimethylpyrrolo[2,3-d]pyrimidine.
| Compound Name | 7-(3,3-dimethylbut-1-en-2-yloxymethyl)-2,4-dimethylpyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 157442770 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 7-(3,3-dimethylbut-1-en-2-yloxymethyl)-2,4-dimethylpyrrolo[2,3-d]pyrimidine |
| SMILES | C=C(OCn1ccc2c(C)nc(C)nc21)C(C)(C)C |
| InChI | InChI=1S/C15H21N3O/c1-10-13-7-8-18(14(13)17-12(3)16-10)9-19-11(2)15(4,5)6/h7-8H,2,9H2,1,3-6H3 |
| InChIKey | BRWBHSKNVGFEDJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|