C11H14N2O — CID 56839063
1-ethyl-4,6-dimethylpyrrolo[2,3-b]pyridin-5-ol (PubChem CID 56839063) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-ethyl-4,6-dimethylpyrrolo[2,3-b]pyridin-5-ol.
| Compound Name | 1-ethyl-4,6-dimethylpyrrolo[2,3-b]pyridin-5-ol |
|---|---|
| PubChem CID | 56839063 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 1-ethyl-4,6-dimethylpyrrolo[2,3-b]pyridin-5-ol |
| SMILES | CCn1ccc2c(C)c(O)c(C)nc21 |
| InChI | InChI=1S/C11H14N2O/c1-4-13-6-5-9-7(2)10(14)8(3)12-11(9)13/h5-6,14H,4H2,1-3H3 |
| InChIKey | BZPYSVOHVKCDKF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |