C10H13N3 — CID 166103994
3,5-diethylpyrrolo[2,3-b]pyrazine (PubChem CID 166103994) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is 3,5-diethylpyrrolo[2,3-b]pyrazine.
| Compound Name | 3,5-diethylpyrrolo[2,3-b]pyrazine |
|---|---|
| PubChem CID | 166103994 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 3,5-diethylpyrrolo[2,3-b]pyrazine |
| SMILES | CCc1cnc2ccn(CC)c2n1 |
| InChI | InChI=1S/C10H13N3/c1-3-8-7-11-9-5-6-13(4-2)10(9)12-8/h5-7H,3-4H2,1-2H3 |
| InChIKey | CIKMKUDIWIGMMC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |