C37H48BNSi — CID 140738929
[6-[3-bis(2,4,6-trimethylphenyl)boranylphenyl]-4-(3-methylbutan-2-yl)-3-pyridinyl]-trimethylsilane (PubChem CID 140738929) has the molecular formula C37H48BNSi and a molecular weight of 545.70 g/mol. Its IUPAC name is [6-[3-bis(2,4,6-trimethylphenyl)boranylphenyl]-4-(3-methylbutan-2-yl)-3-pyridinyl]-trimethylsilane.
| Compound Name | [6-[3-bis(2,4,6-trimethylphenyl)boranylphenyl]-4-(3-methylbutan-2-yl)-3-pyridinyl]-trimethylsilane |
|---|---|
| PubChem CID | 140738929 |
| Molecular Formula | C37H48BNSi |
| Molecular Weight | 545.70 g/mol |
| Exact Mass | 545.36 |
| IUPAC Name | [6-[3-bis(2,4,6-trimethylphenyl)boranylphenyl]-4-(3-methylbutan-2-yl)-3-pyridinyl]-trimethylsilane |
| SMILES | Cc1cc(C)c(B(c2cccc(-c3cc(C(C)C(C)C)c([Si](C)(C)C)cn3)c2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C37H48BNSi/c1-23(2)30(9)33-21-34(39-22-35(33)40(10,11)12)31-14-13-15-32(20-31)38(36-26(5)16-24(3)17-27(36)6)37-28(7)18-25(4)19-29(37)8/h13-23,30H,1-12H3 |
| InChIKey | ITKODYCLJKVGNO-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.70 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|