C21H31NSi — CID 169038830
[6-(2,4-dimethylphenyl)-4-(3-methylbutan-2-yl)-3-pyridinyl]-trimethylsilane (PubChem CID 169038830) has the molecular formula C21H31NSi and a molecular weight of 325.57 g/mol. Its IUPAC name is [6-(2,4-dimethylphenyl)-4-(3-methylbutan-2-yl)-3-pyridinyl]-trimethylsilane.
| Compound Name | [6-(2,4-dimethylphenyl)-4-(3-methylbutan-2-yl)-3-pyridinyl]-trimethylsilane |
|---|---|
| PubChem CID | 169038830 |
| Molecular Formula | C21H31NSi |
| Molecular Weight | 325.57 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | [6-(2,4-dimethylphenyl)-4-(3-methylbutan-2-yl)-3-pyridinyl]-trimethylsilane |
| SMILES | Cc1ccc(-c2cc(C(C)C(C)C)c([Si](C)(C)C)cn2)c(C)c1 |
| InChI | InChI=1S/C21H31NSi/c1-14(2)17(5)19-12-20(22-13-21(19)23(6,7)8)18-10-9-15(3)11-16(18)4/h9-14,17H,1-8H3 |
| InChIKey | GLSBEWVCZMYRGI-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.57 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|