C15H13N — CID 175646938
2-(2,4-dimethylphenyl)-5-ethynylpyridine (PubChem CID 175646938) has the molecular formula C15H13N and a molecular weight of 207.28 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-5-ethynylpyridine.
| Compound Name | 2-(2,4-dimethylphenyl)-5-ethynylpyridine |
|---|---|
| PubChem CID | 175646938 |
| Molecular Formula | C15H13N |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-5-ethynylpyridine |
| SMILES | C#Cc1ccc(-c2ccc(C)cc2C)nc1 |
| InChI | InChI=1S/C15H13N/c1-4-13-6-8-15(16-10-13)14-7-5-11(2)9-12(14)3/h1,5-10H,2-3H3 |
| InChIKey | LDHUSHUGYUSXGO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|