C13H7F2N — CID 175646962
2-(3,5-difluorophenyl)-5-ethynylpyridine (PubChem CID 175646962) has the molecular formula C13H7F2N and a molecular weight of 215.20 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-5-ethynylpyridine.
| Compound Name | 2-(3,5-difluorophenyl)-5-ethynylpyridine |
|---|---|
| PubChem CID | 175646962 |
| Molecular Formula | C13H7F2N |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 2-(3,5-difluorophenyl)-5-ethynylpyridine |
| SMILES | C#Cc1ccc(-c2cc(F)cc(F)c2)nc1 |
| InChI | InChI=1S/C13H7F2N/c1-2-9-3-4-13(16-8-9)10-5-11(14)7-12(15)6-10/h1,3-8H |
| InChIKey | RPBIKBVWJVXTBI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|