C11H13NO3 — CID 140740894
(1S)-6-methoxy-2-methyl-1H-isoquinoline-1,7-diol (PubChem CID 140740894) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is (1S)-6-methoxy-2-methyl-1H-isoquinoline-1,7-diol.
| Compound Name | (1S)-6-methoxy-2-methyl-1H-isoquinoline-1,7-diol |
|---|---|
| PubChem CID | 140740894 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (1S)-6-methoxy-2-methyl-1H-isoquinoline-1,7-diol |
| SMILES | COc1cc2c(cc1O)[C@H](O)N(C)C=C2 |
| InChI | InChI=1S/C11H13NO3/c1-12-4-3-7-5-10(15-2)9(13)6-8(7)11(12)14/h3-6,11,13-14H,1-2H3/t11-/m0/s1 |
| InChIKey | BCGJSGMJJOVEOV-NSHDSACASA-N |
| XLogP | 1.31 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |