C14H17N5O — CID 140742531
3-amino-1-[(1S,2R)-2-isocyanocycloheptyl]-5H-pyrazolo[4,3-c]pyridin-4-one (PubChem CID 140742531) has the molecular formula C14H17N5O and a molecular weight of 271.32 g/mol. Its IUPAC name is 3-amino-1-[(1S,2R)-2-isocyanocycloheptyl]-5H-pyrazolo[4,3-c]pyridin-4-one.
| Compound Name | 3-amino-1-[(1S,2R)-2-isocyanocycloheptyl]-5H-pyrazolo[4,3-c]pyridin-4-one |
|---|---|
| PubChem CID | 140742531 |
| Molecular Formula | C14H17N5O |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 3-amino-1-[(1S,2R)-2-isocyanocycloheptyl]-5H-pyrazolo[4,3-c]pyridin-4-one |
| SMILES | [C-]#[N+][C@@H]1CCCCC[C@@H]1n1nc(N)c2c(=O)[nH]ccc21 |
| InChI | InChI=1S/C14H17N5O/c1-16-9-5-3-2-4-6-10(9)19-11-7-8-17-14(20)12(11)13(15)18-19/h7-10H,2-6H2,(H2,15,18)(H,17,20)/t9-,10+/m1/s1 |
| InChIKey | XCMXNINZBDRXQR-ZJUUUORDSA-N |
| XLogP | 2.10 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|