C16H20N4O4S — CID 162338575
3-(4-aminosulfanylphenyl)-1-(oxolan-3-yl)-5H-pyrazolo[4,3-c]pyridin-4-one;dihydrate (PubChem CID 162338575) has the molecular formula C16H20N4O4S and a molecular weight of 364.43 g/mol. Its IUPAC name is 3-(4-aminosulfanylphenyl)-1-(oxolan-3-yl)-5H-pyrazolo[4,3-c]pyridin-4-one;dihydrate.
| Compound Name | 3-(4-aminosulfanylphenyl)-1-(oxolan-3-yl)-5H-pyrazolo[4,3-c]pyridin-4-one;dihydrate |
|---|---|
| PubChem CID | 162338575 |
| Molecular Formula | C16H20N4O4S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 3-(4-aminosulfanylphenyl)-1-(oxolan-3-yl)-5H-pyrazolo[4,3-c]pyridin-4-one;dihydrate |
| SMILES | NSc1ccc(-c2nn(C3CCOC3)c3cc[nH]c(=O)c23)cc1.O.O |
| InChI | InChI=1S/C16H16N4O2S.2H2O/c17-23-12-3-1-10(2-4-12)15-14-13(5-7-18-16(14)21)20(19-15)11-6-8-22-9-11;;/h1-5,7,11H,6,8-9,17H2,(H,18,21);2*1H2 |
| InChIKey | HIBSJXIVGUUHBI-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 148.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|