C41H30BO4- — CID 140746310
[4-[2-(9,10-dioxoanthracene-2-carbonyl)oxyethyl]phenyl]-triphenylboranuide (PubChem CID 140746310) has the molecular formula C41H30BO4- and a molecular weight of 597.50 g/mol. Its IUPAC name is [4-[2-(9,10-dioxoanthracene-2-carbonyl)oxyethyl]phenyl]-triphenylboranuide.
| Compound Name | [4-[2-(9,10-dioxoanthracene-2-carbonyl)oxyethyl]phenyl]-triphenylboranuide |
|---|---|
| PubChem CID | 140746310 |
| Molecular Formula | C41H30BO4- |
| Molecular Weight | 597.50 g/mol |
| Exact Mass | 597.22 |
| IUPAC Name | [4-[2-(9,10-dioxoanthracene-2-carbonyl)oxyethyl]phenyl]-triphenylboranuide |
| SMILES | O=C(OCCc1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C41H30BO4/c43-39-35-18-10-11-19-36(35)40(44)38-28-30(22-25-37(38)39)41(45)46-27-26-29-20-23-34(24-21-29)42(31-12-4-1-5-13-31,32-14-6-2-7-15-32)33-16-8-3-9-17-33/h1-25,28H,26-27H2/q-1 |
| InChIKey | WUWQYLRDBPPJMC-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|