C35H25BO5 — CID 144855749
2-(4-diphenylboranylphenoxy)ethyl 9,10-dioxoanthracene-2-carboxylate (PubChem CID 144855749) has the molecular formula C35H25BO5 and a molecular weight of 536.39 g/mol. Its IUPAC name is 2-(4-diphenylboranylphenoxy)ethyl 9,10-dioxoanthracene-2-carboxylate.
| Compound Name | 2-(4-diphenylboranylphenoxy)ethyl 9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 144855749 |
| Molecular Formula | C35H25BO5 |
| Molecular Weight | 536.39 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | 2-(4-diphenylboranylphenoxy)ethyl 9,10-dioxoanthracene-2-carboxylate |
| SMILES | O=C(OCCOc1ccc(B(c2ccccc2)c2ccccc2)cc1)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C35H25BO5/c37-33-29-13-7-8-14-30(29)34(38)32-23-24(15-20-31(32)33)35(39)41-22-21-40-28-18-16-27(17-19-28)36(25-9-3-1-4-10-25)26-11-5-2-6-12-26/h1-20,23H,21-22H2 |
| InChIKey | PWCFGHBKNGVRBI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|