C10H18N4O3 — CID 140746517
1-[2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl]oxyethanol (PubChem CID 140746517) has the molecular formula C10H18N4O3 and a molecular weight of 242.28 g/mol. Its IUPAC name is 1-[2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl]oxyethanol.
| Compound Name | 1-[2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl]oxyethanol |
|---|---|
| PubChem CID | 140746517 |
| Molecular Formula | C10H18N4O3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 1-[2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl]oxyethanol |
| SMILES | CC(C)COc1nc(N)nc(OC(C)O)c1N |
| InChI | InChI=1S/C10H18N4O3/c1-5(2)4-16-8-7(11)9(17-6(3)15)14-10(12)13-8/h5-6,15H,4,11H2,1-3H3,(H2,12,13,14) |
| InChIKey | XHULLBIBDWNURA-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 116.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|