C12H14F3NOS — CID 140746980
2-[(2R)-1-(2,2,2-trifluoroethylsulfanyl)propan-2-yl]benzamide (PubChem CID 140746980) has the molecular formula C12H14F3NOS and a molecular weight of 277.31 g/mol. Its IUPAC name is 2-[(2R)-1-(2,2,2-trifluoroethylsulfanyl)propan-2-yl]benzamide.
| Compound Name | 2-[(2R)-1-(2,2,2-trifluoroethylsulfanyl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 140746980 |
| Molecular Formula | C12H14F3NOS |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2-[(2R)-1-(2,2,2-trifluoroethylsulfanyl)propan-2-yl]benzamide |
| SMILES | C[C@@H](CSCC(F)(F)F)c1ccccc1C(N)=O |
| InChI | InChI=1S/C12H14F3NOS/c1-8(6-18-7-12(13,14)15)9-4-2-3-5-10(9)11(16)17/h2-5,8H,6-7H2,1H3,(H2,16,17)/t8-/m0/s1 |
| InChIKey | VXCVIGYUNBZPNW-QMMMGPOBSA-N |
| XLogP | 3.18 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |