C21H22F2O6 — CID 140747939
4-[2-[1,1-difluoro-2-(2-propoxyethoxy)ethoxy]benzoyl]benzoic acid (PubChem CID 140747939) has the molecular formula C21H22F2O6 and a molecular weight of 408.40 g/mol. Its IUPAC name is 4-[2-[1,1-difluoro-2-(2-propoxyethoxy)ethoxy]benzoyl]benzoic acid.
| Compound Name | 4-[2-[1,1-difluoro-2-(2-propoxyethoxy)ethoxy]benzoyl]benzoic acid |
|---|---|
| PubChem CID | 140747939 |
| Molecular Formula | C21H22F2O6 |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 4-[2-[1,1-difluoro-2-(2-propoxyethoxy)ethoxy]benzoyl]benzoic acid |
| SMILES | CCCOCCOCC(F)(F)Oc1ccccc1C(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H22F2O6/c1-2-11-27-12-13-28-14-21(22,23)29-18-6-4-3-5-17(18)19(24)15-7-9-16(10-8-15)20(25)26/h3-10H,2,11-14H2,1H3,(H,25,26) |
| InChIKey | UCPOVYUCEXLVOL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|