C20H24N2O4 — CID 140750465
phenyl N-[3-(2-amino-2-oxoethyl)-5-tert-butyl-2-methoxyphenyl]carbamate (PubChem CID 140750465) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is phenyl N-[3-(2-amino-2-oxoethyl)-5-tert-butyl-2-methoxyphenyl]carbamate.
| Compound Name | phenyl N-[3-(2-amino-2-oxoethyl)-5-tert-butyl-2-methoxyphenyl]carbamate |
|---|---|
| PubChem CID | 140750465 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | phenyl N-[3-(2-amino-2-oxoethyl)-5-tert-butyl-2-methoxyphenyl]carbamate |
| SMILES | COc1c(CC(N)=O)cc(C(C)(C)C)cc1NC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C20H24N2O4/c1-20(2,3)14-10-13(11-17(21)23)18(25-4)16(12-14)22-19(24)26-15-8-6-5-7-9-15/h5-10,12H,11H2,1-4H3,(H2,21,23)(H,22,24) |
| InChIKey | SVZYBKWZAPPFBL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |