C32H30F5NO7S3 — CID 140753379
[2-(adamantane-1-carbonyloxy)-1,1,3,3,3-pentafluoropropyl]sulfonyl-(4-diphenylsulfoniophenoxy)sulfonylazanide (PubChem CID 140753379) has the molecular formula C32H30F5NO7S3 and a molecular weight of 731.78 g/mol. Its IUPAC name is [2-(adamantane-1-carbonyloxy)-1,1,3,3,3-pentafluoropropyl]sulfonyl-(4-diphenylsulfoniophenoxy)sulfonylazanide.
| Compound Name | [2-(adamantane-1-carbonyloxy)-1,1,3,3,3-pentafluoropropyl]sulfonyl-(4-diphenylsulfoniophenoxy)sulfonylazanide |
|---|---|
| PubChem CID | 140753379 |
| Molecular Formula | C32H30F5NO7S3 |
| Molecular Weight | 731.78 g/mol |
| Exact Mass | 731.11 |
| IUPAC Name | [2-(adamantane-1-carbonyloxy)-1,1,3,3,3-pentafluoropropyl]sulfonyl-(4-diphenylsulfoniophenoxy)sulfonylazanide |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)S(=O)(=O)[N-]S(=O)(=O)Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C32H30F5NO7S3/c33-31(34,35)28(44-29(39)30-18-21-15-22(19-30)17-23(16-21)20-30)32(36,37)47(40,41)38-48(42,43)45-24-11-13-27(14-12-24)46(25-7-3-1-4-8-25)26-9-5-2-6-10-26/h1-14,21-23,28H,15-20H2 |
| InChIKey | OTDXFJZZKONYAF-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 117.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.78 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|