C44H25N5 — CID 140761302
7'-isocyano-10-(3-pyrido[4,3-b]indol-5-ylphenyl)spiro[acridine-9,9'-fluorene]-2'-carbonitrile (PubChem CID 140761302) has the molecular formula C44H25N5 and a molecular weight of 623.72 g/mol. Its IUPAC name is 7'-isocyano-10-(3-pyrido[4,3-b]indol-5-ylphenyl)spiro[acridine-9,9'-fluorene]-2'-carbonitrile.
| Compound Name | 7'-isocyano-10-(3-pyrido[4,3-b]indol-5-ylphenyl)spiro[acridine-9,9'-fluorene]-2'-carbonitrile |
|---|---|
| PubChem CID | 140761302 |
| Molecular Formula | C44H25N5 |
| Molecular Weight | 623.72 g/mol |
| Exact Mass | 623.21 |
| IUPAC Name | 7'-isocyano-10-(3-pyrido[4,3-b]indol-5-ylphenyl)spiro[acridine-9,9'-fluorene]-2'-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)C1(c3cc(C#N)ccc3-2)c2ccccc2N(c2cccc(-n3c4ccccc4c4cnccc43)c2)c2ccccc21 |
| InChI | InChI=1S/C44H25N5/c1-46-29-18-20-33-32-19-17-28(26-45)23-38(32)44(39(33)24-29)36-12-3-6-15-42(36)49(43-16-7-4-13-37(43)44)31-10-8-9-30(25-31)48-40-14-5-2-11-34(40)35-27-47-22-21-41(35)48/h2-25,27H |
| InChIKey | BHOVOIREQUCAKS-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 49.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.72 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|