C21H19F3N6O4 — CID 140765739
N-[(1R)-2,2-dimethyl-1-[3-nitro-4-(trifluoromethyl)phenyl]propyl]-6-oxo-2-pyrimidin-2-yl-1H-pyrimidine-4-carboxamide (PubChem CID 140765739) has the molecular formula C21H19F3N6O4 and a molecular weight of 476.42 g/mol. Its IUPAC name is N-[(1R)-2,2-dimethyl-1-[3-nitro-4-(trifluoromethyl)phenyl]propyl]-6-oxo-2-pyrimidin-2-yl-1H-pyrimidine-4-carboxamide.
| Compound Name | N-[(1R)-2,2-dimethyl-1-[3-nitro-4-(trifluoromethyl)phenyl]propyl]-6-oxo-2-pyrimidin-2-yl-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 140765739 |
| Molecular Formula | C21H19F3N6O4 |
| Molecular Weight | 476.42 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | N-[(1R)-2,2-dimethyl-1-[3-nitro-4-(trifluoromethyl)phenyl]propyl]-6-oxo-2-pyrimidin-2-yl-1H-pyrimidine-4-carboxamide |
| SMILES | CC(C)(C)[C@@H](NC(=O)c1cc(=O)[nH]c(-c2ncccn2)n1)c1ccc(C(F)(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H19F3N6O4/c1-20(2,3)16(11-5-6-12(21(22,23)24)14(9-11)30(33)34)29-19(32)13-10-15(31)28-18(27-13)17-25-7-4-8-26-17/h4-10,16H,1-3H3,(H,29,32)(H,27,28,31)/t16-/m0/s1 |
| InChIKey | RXOJLMUVVTYYTD-INIZCTEOSA-N |
| XLogP | 3.67 |
| TPSA | 143.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|