C20H36N2O6S2 — CID 140766318
benzene-1,4-disulfonate;bis(1-ethyl-1-methylpyrrolidin-1-ium) (PubChem CID 140766318) has the molecular formula C20H36N2O6S2 and a molecular weight of 464.65 g/mol. Its IUPAC name is benzene-1,4-disulfonate;bis(1-ethyl-1-methylpyrrolidin-1-ium).
| Compound Name | benzene-1,4-disulfonate;bis(1-ethyl-1-methylpyrrolidin-1-ium) |
|---|---|
| PubChem CID | 140766318 |
| Molecular Formula | C20H36N2O6S2 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | benzene-1,4-disulfonate;bis(1-ethyl-1-methylpyrrolidin-1-ium) |
| SMILES | CC[N+]1(C)CCCC1.CC[N+]1(C)CCCC1.O=S(=O)([O-])c1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/2C7H16N.C6H6O6S2/c2*1-3-8(2)6-4-5-7-8;7-13(8,9)5-1-2-6(4-3-5)14(10,11)12/h2*3-7H2,1-2H3;1-4H,(H,7,8,9)(H,10,11,12)/q2*+1;/p-2 |
| InChIKey | VYMUVBLKMJZLIG-UHFFFAOYSA-L |
| XLogP | 1.99 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|