About benzenesulfonate;triethyl(methyl)azanium
benzenesulfonate;triethyl(methyl)azanium (PubChem CID 139909989) has the molecular formula C13H23NO3S
and a molecular weight of 273.40 g/mol. Its IUPAC name is benzenesulfonate;triethyl(methyl)azanium.
Molecular Properties
| Compound Name | benzenesulfonate;triethyl(methyl)azanium |
| PubChem CID | 139909989 |
| Molecular Formula | C13H23NO3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | benzenesulfonate;triethyl(methyl)azanium |
| SMILES | CC[N+](C)(CC)CC.O=S(=O)([O-])c1ccccc1 |
| InChI | InChI=1S/C7H18N.C6H6O3S/c1-5-8(4,6-2)7-3;7-10(8,9)6-4-2-1-3-5-6/h5-7H2,1-4H3;1-5H,(H,7,8,9)/q+1;/p-1 |
| InChIKey | PDQHJNSJXAZBLQ-UHFFFAOYSA-M |
| XLogP | 2.08 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzenesulfonate;triethyl(methyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonate;triethyl(methyl)azanium?
The IUPAC name of benzenesulfonate;triethyl(methyl)azanium (CID 139909989) is benzenesulfonate;triethyl(methyl)azanium.
What is the SMILES notation for benzenesulfonate;triethyl(methyl)azanium?
The canonical SMILES for benzenesulfonate;triethyl(methyl)azanium is CC[N+](C)(CC)CC.O=S(=O)([O-])c1ccccc1.
What is the InChIKey of benzenesulfonate;triethyl(methyl)azanium?
The InChIKey is PDQHJNSJXAZBLQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H18N.C6H6O3S/c1-5-8(4,6-2)7-3;7-10(8,9)6-4-2-1-3-5-6/h5-7H2,1-4H3;1-5H,(H,7,8,9)/q+1;/p-1.
What are the key properties of benzenesulfonate;triethyl(methyl)azanium?
benzenesulfonate;triethyl(methyl)azanium has a molecular weight of 273.40 g/mol, XLogP of 2.08, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonate;triethyl(methyl)azanium is sourced from PubChem (CID 139909989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).