C9H13NOS — CID 14076694
(4-ethylsulfanyl-3-methyl-2-pyridinyl)methanol (PubChem CID 14076694) has the molecular formula C9H13NOS and a molecular weight of 183.28 g/mol. Its IUPAC name is (4-ethylsulfanyl-3-methyl-2-pyridinyl)methanol.
| Compound Name | (4-ethylsulfanyl-3-methyl-2-pyridinyl)methanol |
|---|---|
| PubChem CID | 14076694 |
| Molecular Formula | C9H13NOS |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | (4-ethylsulfanyl-3-methyl-2-pyridinyl)methanol |
| SMILES | CCSc1ccnc(CO)c1C |
| InChI | InChI=1S/C9H13NOS/c1-3-12-9-4-5-10-8(6-11)7(9)2/h4-5,11H,3,6H2,1-2H3 |
| InChIKey | HUPLYFBINRYRTD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |