C16H27NO3S — CID 139756617
[4-[4-(4-methoxybutoxy)butylsulfanyl]-3-methyl-2-pyridinyl]methanol (PubChem CID 139756617) has the molecular formula C16H27NO3S and a molecular weight of 313.46 g/mol. Its IUPAC name is [4-[4-(4-methoxybutoxy)butylsulfanyl]-3-methyl-2-pyridinyl]methanol.
| Compound Name | [4-[4-(4-methoxybutoxy)butylsulfanyl]-3-methyl-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 139756617 |
| Molecular Formula | C16H27NO3S |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | [4-[4-(4-methoxybutoxy)butylsulfanyl]-3-methyl-2-pyridinyl]methanol |
| SMILES | COCCCCOCCCCSc1ccnc(CO)c1C |
| InChI | InChI=1S/C16H27NO3S/c1-14-15(13-18)17-8-7-16(14)21-12-6-5-11-20-10-4-3-9-19-2/h7-8,18H,3-6,9-13H2,1-2H3 |
| InChIKey | VENSFXBZBPYQRN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|