C13H20FNO3S — CID 139756465
[4-[2-[2-(2-fluoroethoxy)ethoxy]ethylsulfanyl]-3-methyl-2-pyridinyl]methanol (PubChem CID 139756465) has the molecular formula C13H20FNO3S and a molecular weight of 289.37 g/mol. Its IUPAC name is [4-[2-[2-(2-fluoroethoxy)ethoxy]ethylsulfanyl]-3-methyl-2-pyridinyl]methanol.
| Compound Name | [4-[2-[2-(2-fluoroethoxy)ethoxy]ethylsulfanyl]-3-methyl-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 139756465 |
| Molecular Formula | C13H20FNO3S |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | [4-[2-[2-(2-fluoroethoxy)ethoxy]ethylsulfanyl]-3-methyl-2-pyridinyl]methanol |
| SMILES | Cc1c(SCCOCCOCCF)ccnc1CO |
| InChI | InChI=1S/C13H20FNO3S/c1-11-12(10-16)15-4-2-13(11)19-9-8-18-7-6-17-5-3-14/h2,4,16H,3,5-10H2,1H3 |
| InChIKey | TUMVNBDSMOYZGM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|