C15H22F3NO4S — CID 139756452
[3-methyl-4-[2-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethoxy]ethylsulfanyl]-2-pyridinyl]methanol (PubChem CID 139756452) has the molecular formula C15H22F3NO4S and a molecular weight of 369.41 g/mol. Its IUPAC name is [3-methyl-4-[2-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethoxy]ethylsulfanyl]-2-pyridinyl]methanol.
| Compound Name | [3-methyl-4-[2-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethoxy]ethylsulfanyl]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 139756452 |
| Molecular Formula | C15H22F3NO4S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | [3-methyl-4-[2-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethoxy]ethylsulfanyl]-2-pyridinyl]methanol |
| SMILES | Cc1c(SCCOCCOCCOCC(F)(F)F)ccnc1CO |
| InChI | InChI=1S/C15H22F3NO4S/c1-12-13(10-20)19-3-2-14(12)24-9-8-22-5-4-21-6-7-23-11-15(16,17)18/h2-3,20H,4-11H2,1H3 |
| InChIKey | VRZLQJQWGJTLSA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|