C14H20F3NO3S — CID 139756438
[3-ethyl-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]-2-pyridinyl]methanol (PubChem CID 139756438) has the molecular formula C14H20F3NO3S and a molecular weight of 339.38 g/mol. Its IUPAC name is [3-ethyl-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]-2-pyridinyl]methanol.
| Compound Name | [3-ethyl-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 139756438 |
| Molecular Formula | C14H20F3NO3S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | [3-ethyl-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]-2-pyridinyl]methanol |
| SMILES | CCc1c(SCCOCCOCC(F)(F)F)ccnc1CO |
| InChI | InChI=1S/C14H20F3NO3S/c1-2-11-12(9-19)18-4-3-13(11)22-8-7-20-5-6-21-10-14(15,16)17/h3-4,19H,2,5-10H2,1H3 |
| InChIKey | KGADEHNBEKCBLK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|