C10H14ClNS2 — CID 141001597
3-[[2-(chloromethyl)-3-methyl-4-pyridinyl]sulfanyl]propane-1-thiol (PubChem CID 141001597) has the molecular formula C10H14ClNS2 and a molecular weight of 247.82 g/mol. Its IUPAC name is 3-[[2-(chloromethyl)-3-methyl-4-pyridinyl]sulfanyl]propane-1-thiol.
| Compound Name | 3-[[2-(chloromethyl)-3-methyl-4-pyridinyl]sulfanyl]propane-1-thiol |
|---|---|
| PubChem CID | 141001597 |
| Molecular Formula | C10H14ClNS2 |
| Molecular Weight | 247.82 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 3-[[2-(chloromethyl)-3-methyl-4-pyridinyl]sulfanyl]propane-1-thiol |
| SMILES | Cc1c(SCCCS)ccnc1CCl |
| InChI | InChI=1S/C10H14ClNS2/c1-8-9(7-11)12-4-3-10(8)14-6-2-5-13/h3-4,13H,2,5-7H2,1H3 |
| InChIKey | AKIAWXASHKWVGZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.82 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|