C34H56Si — CID 140769835
[(3aS)-2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-[(3R,3aS)-2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-methyl-propylsilane (PubChem CID 140769835) has the molecular formula C34H56Si and a molecular weight of 492.91 g/mol. Its IUPAC name is [(3aS)-2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-[(3R,3aS)-2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-methyl-propylsilane.
| Compound Name | [(3aS)-2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-[(3R,3aS)-2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-methyl-propylsilane |
|---|---|
| PubChem CID | 140769835 |
| Molecular Formula | C34H56Si |
| Molecular Weight | 492.91 g/mol |
| Exact Mass | 492.42 |
| IUPAC Name | [(3aS)-2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-[(3R,3aS)-2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-methyl-propylsilane |
| SMILES | CCC[Si](C)(C1C(C)C(C)[C@@H]2C(C)=C(C)C(C)=C(C)C12)C1C2C(C)=C(C)C(C)=C(C)[C@H]2[C@@H](C)C1C |
| InChI | InChI=1S/C34H56Si/c1-15-16-35(14,33-27(12)25(10)29-21(6)17(2)19(4)23(8)31(29)33)34-28(13)26(11)30-22(7)18(3)20(5)24(9)32(30)34/h25-34H,15-16H2,1-14H3/t25-,26?,27?,28?,29-,30-,31?,32?,33?,34?,35?/m0/s1 |
| InChIKey | NXHFYLSDXQZBJW-JOYYFZDJSA-N |
| XLogP | 10.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.91 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|