C16H13F6O6S- — CID 140770671
3,3,3-trifluoro-2-[3-(3-methylbuta-1,3-dien-2-yloxy)benzoyl]oxy-2-(trifluoromethyl)propane-1-sulfonate (PubChem CID 140770671) has the molecular formula C16H13F6O6S- and a molecular weight of 447.33 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[3-(3-methylbuta-1,3-dien-2-yloxy)benzoyl]oxy-2-(trifluoromethyl)propane-1-sulfonate.
| Compound Name | 3,3,3-trifluoro-2-[3-(3-methylbuta-1,3-dien-2-yloxy)benzoyl]oxy-2-(trifluoromethyl)propane-1-sulfonate |
|---|---|
| PubChem CID | 140770671 |
| Molecular Formula | C16H13F6O6S- |
| Molecular Weight | 447.33 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | 3,3,3-trifluoro-2-[3-(3-methylbuta-1,3-dien-2-yloxy)benzoyl]oxy-2-(trifluoromethyl)propane-1-sulfonate |
| SMILES | C=C(C)C(=C)Oc1cccc(C(=O)OC(CS(=O)(=O)[O-])(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C16H14F6O6S/c1-9(2)10(3)27-12-6-4-5-11(7-12)13(23)28-14(15(17,18)19,16(20,21)22)8-29(24,25)26/h4-7H,1,3,8H2,2H3,(H,24,25,26)/p-1 |
| InChIKey | DFYTUBSMCLLXNA-UHFFFAOYSA-M |
| XLogP | 3.72 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|