C9H6F4O3 — CID 578680
3-(1,1,2,2-tetrafluoroethoxy)benzoic acid (PubChem CID 578680) has the molecular formula C9H6F4O3 and a molecular weight of 238.14 g/mol. Its IUPAC name is 3-(1,1,2,2-tetrafluoroethoxy)benzoic acid.
| Compound Name | 3-(1,1,2,2-tetrafluoroethoxy)benzoic acid |
|---|---|
| PubChem CID | 578680 |
| Molecular Formula | C9H6F4O3 |
| Molecular Weight | 238.14 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 3-(1,1,2,2-tetrafluoroethoxy)benzoic acid |
| SMILES | O=C(O)c1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C9H6F4O3/c10-8(11)9(12,13)16-6-3-1-2-5(4-6)7(14)15/h1-4,8H,(H,14,15) |
| InChIKey | KXSUHQSIHGQDQV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.14 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|