C11H4F6O5 — CID 91735139
(2,2,2-trifluoroacetyl) 3-(2,2,2-trifluoroacetyl)oxybenzoate (PubChem CID 91735139) has the molecular formula C11H4F6O5 and a molecular weight of 330.14 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-(2,2,2-trifluoroacetyl)oxybenzoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-(2,2,2-trifluoroacetyl)oxybenzoate |
|---|---|
| PubChem CID | 91735139 |
| Molecular Formula | C11H4F6O5 |
| Molecular Weight | 330.14 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-(2,2,2-trifluoroacetyl)oxybenzoate |
| SMILES | O=C(OC(=O)C(F)(F)F)c1cccc(OC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H4F6O5/c12-10(13,14)8(19)21-6-3-1-2-5(4-6)7(18)22-9(20)11(15,16)17/h1-4H |
| InChIKey | QOQCOHFUGYJITO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.14 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|