About 3-propan-2-yloxybenzoic acid
3-propan-2-yloxybenzoic acid (PubChem CID 586709) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 3-propan-2-yloxybenzoic acid.
Molecular Properties
| Compound Name | 3-propan-2-yloxybenzoic acid |
| PubChem CID | 586709 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 3-propan-2-yloxybenzoic acid |
| SMILES | CC(C)Oc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C10H12O3/c1-7(2)13-9-5-3-4-8(6-9)10(11)12/h3-7H,1-2H3,(H,11,12) |
| InChIKey | QPVBLLQBUNVSJT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-propan-2-yloxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yloxybenzoic acid?
The IUPAC name of 3-propan-2-yloxybenzoic acid (CID 586709) is 3-propan-2-yloxybenzoic acid.
What is the SMILES notation for 3-propan-2-yloxybenzoic acid?
The canonical SMILES for 3-propan-2-yloxybenzoic acid is CC(C)Oc1cccc(C(=O)O)c1.
What is the InChIKey of 3-propan-2-yloxybenzoic acid?
The InChIKey is QPVBLLQBUNVSJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-7(2)13-9-5-3-4-8(6-9)10(11)12/h3-7H,1-2H3,(H,11,12).
What are the key properties of 3-propan-2-yloxybenzoic acid?
3-propan-2-yloxybenzoic acid has a molecular weight of 180.20 g/mol, XLogP of 2.17, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yloxybenzoic acid is sourced from PubChem (CID 586709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).