C14H13N6O3S+ — CID 140774818
2-[[5-[3-(2-methyl-1H-pyrazol-2-ium-3-yl)-5-nitrosophenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 140774818) has the molecular formula C14H13N6O3S+ and a molecular weight of 345.36 g/mol. Its IUPAC name is 2-[[5-[3-(2-methyl-1H-pyrazol-2-ium-3-yl)-5-nitrosophenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-[3-(2-methyl-1H-pyrazol-2-ium-3-yl)-5-nitrosophenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 140774818 |
| Molecular Formula | C14H13N6O3S+ |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 2-[[5-[3-(2-methyl-1H-pyrazol-2-ium-3-yl)-5-nitrosophenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | C[n+]1[nH]ccc1-c1cc(N=O)cc(-c2nc(SCC(=O)O)n[nH]2)c1 |
| InChI | InChI=1S/C14H12N6O3S/c1-20-11(2-3-15-20)8-4-9(6-10(5-8)19-23)13-16-14(18-17-13)24-7-12(21)22/h2-6H,7H2,1H3,(H2,16,17,18,21,22)/p+1 |
| InChIKey | BLIVDZXTIOOCQF-UHFFFAOYSA-O |
| XLogP | 1.87 |
| TPSA | 127.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|