C23H36O2Si3 — CID 140776335
triethyl-[2-[[methoxy(dimethyl)silyl]oxy-diphenylsilyl]ethenyl]silane (PubChem CID 140776335) has the molecular formula C23H36O2Si3 and a molecular weight of 428.80 g/mol. Its IUPAC name is triethyl-[2-[[methoxy(dimethyl)silyl]oxy-diphenylsilyl]ethenyl]silane.
| Compound Name | triethyl-[2-[[methoxy(dimethyl)silyl]oxy-diphenylsilyl]ethenyl]silane |
|---|---|
| PubChem CID | 140776335 |
| Molecular Formula | C23H36O2Si3 |
| Molecular Weight | 428.80 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | triethyl-[2-[[methoxy(dimethyl)silyl]oxy-diphenylsilyl]ethenyl]silane |
| SMILES | CC[Si](C=C[Si](O[Si](C)(C)OC)(c1ccccc1)c1ccccc1)(CC)CC |
| InChI | InChI=1S/C23H36O2Si3/c1-7-27(8-2,9-3)20-21-28(25-26(5,6)24-4,22-16-12-10-13-17-22)23-18-14-11-15-19-23/h10-21H,7-9H2,1-6H3 |
| InChIKey | UDUWHSSAXINWFH-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.80 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|