C25H40O2Si3 — CID 140776361
[diethyl(methoxy)silyl]oxy-diphenyl-(2-triethylsilylethenyl)silane (PubChem CID 140776361) has the molecular formula C25H40O2Si3 and a molecular weight of 456.85 g/mol. Its IUPAC name is [diethyl(methoxy)silyl]oxy-diphenyl-(2-triethylsilylethenyl)silane.
| Compound Name | [diethyl(methoxy)silyl]oxy-diphenyl-(2-triethylsilylethenyl)silane |
|---|---|
| PubChem CID | 140776361 |
| Molecular Formula | C25H40O2Si3 |
| Molecular Weight | 456.85 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | [diethyl(methoxy)silyl]oxy-diphenyl-(2-triethylsilylethenyl)silane |
| SMILES | CC[Si](C=C[Si](O[Si](CC)(CC)OC)(c1ccccc1)c1ccccc1)(CC)CC |
| InChI | InChI=1S/C25H40O2Si3/c1-7-28(8-2,9-3)22-23-30(24-18-14-12-15-19-24,25-20-16-13-17-21-25)27-29(10-4,11-5)26-6/h12-23H,7-11H2,1-6H3 |
| InChIKey | QSDBZFXMTXHECM-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.85 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|