C19H34 — CID 140778080
9-(1,1-dideuterio-2,2-dimethylpropyl)-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene (PubChem CID 140778080) has the molecular formula C19H34 and a molecular weight of 264.49 g/mol. Its IUPAC name is 9-(1,1-dideuterio-2,2-dimethylpropyl)-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene.
| Compound Name | 9-(1,1-dideuterio-2,2-dimethylpropyl)-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene |
|---|---|
| PubChem CID | 140778080 |
| Molecular Formula | C19H34 |
| Molecular Weight | 264.49 g/mol |
| Exact Mass | 264.28 |
| IUPAC Name | 9-(1,1-dideuterio-2,2-dimethylpropyl)-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene |
| SMILES | [2H]C([2H])(C1CC2CCCCC2C2CCCCC21)C(C)(C)C |
| InChI | InChI=1S/C19H34/c1-19(2,3)13-15-12-14-8-4-5-9-16(14)18-11-7-6-10-17(15)18/h14-18H,4-13H2,1-3H3/i13D2 |
| InChIKey | SUIDAHLHACVNJQ-KLTYLHELSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.49 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |