C41H68O4 — CID 140780109
2,2-bis(hydroxymethyl)-1,1-bis[2,4,6-tris(2-methylpropyl)phenyl]propane-1,3-diol (PubChem CID 140780109) has the molecular formula C41H68O4 and a molecular weight of 624.99 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)-1,1-bis[2,4,6-tris(2-methylpropyl)phenyl]propane-1,3-diol.
| Compound Name | 2,2-bis(hydroxymethyl)-1,1-bis[2,4,6-tris(2-methylpropyl)phenyl]propane-1,3-diol |
|---|---|
| PubChem CID | 140780109 |
| Molecular Formula | C41H68O4 |
| Molecular Weight | 624.99 g/mol |
| Exact Mass | 624.51 |
| IUPAC Name | 2,2-bis(hydroxymethyl)-1,1-bis[2,4,6-tris(2-methylpropyl)phenyl]propane-1,3-diol |
| SMILES | CC(C)Cc1cc(CC(C)C)c(C(O)(c2c(CC(C)C)cc(CC(C)C)cc2CC(C)C)C(CO)(CO)CO)c(CC(C)C)c1 |
| InChI | InChI=1S/C41H68O4/c1-26(2)13-32-19-34(15-28(5)6)38(35(20-32)16-29(7)8)41(45,40(23-42,24-43)25-44)39-36(17-30(9)10)21-33(14-27(3)4)22-37(39)18-31(11)12/h19-22,26-31,42-45H,13-18,23-25H2,1-12H3 |
| InChIKey | GBLFMHCINGHZKY-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.99 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |